On Target TRPV3_HUMAN 0.25/CHEMBL3696375
For the given ligand Rofecoxib, we have found in our database that, being scored 0.25, the most similar ligand is CHEMBL3696375. Check out the elaboration below.
| Rofecoxib (Given Ligand) | CHEMBL3696375 (Similar Ligand) |
|---|---|
| CS(=O)(=O)c3ccc(/C2=C(c1ccccc1)/C(=O)OC2)cc3 | CC(C)[C@H](CO)NCc1ccnc(n1)c2ccc(cc2)S(=O)(=O)C(F)(F)F |
|
|
|
|
|
|
| 00000040 00801200 00020100 00910200 00100040 00000000 80000080 00000440 01800000 00080840 48002100 60009000 05008000 00010000 c0240002 00080008 0c020410 02000000 44018018 00002000 80010020 18040a00 01800000 08400019 00001400 80000000 00402000 40000420 00400200 00020002 04002000 00810430 | 0000001a 00801a00 00120108 10950e00 000000a0 00104002 00401000 08083049 00000100 10000840 00212004 60008800 01000002 00318000 80220400 000c040c 14000008 02002022 80400000 00402201 80400000 18018000 23800040 08400119 00004000 c0000400 00000000 80201020 00000104 00660400 60008800 000102a0 |