On Target AMPN_HUMAN 0.39/CHEMBL1821978
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.39, the most similar ligand is CHEMBL1821978. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL1821978 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | Cl.NC1CCc2cccc(c2CC1=O)c3ccccc3 |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00012000 01000201 00400102 00010600 00020001 00000002 00000000 00000001 00000800 000808c0 08100000 4000b000 05008000 00200000 60000020 02080008 01020000 02001000 04002000 00000001 00000300 18000200 11004000 00400010 00800000 80000181 00000000 00000041 00004002 0006000a 00022000 00420400 |