On Target AMPN_HUMAN 0.33333334/CHEMBL28650
For the given ligand Pimecrolimus, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL28650. Check out the elaboration below.
| Pimecrolimus (Given Ligand) | CHEMBL28650 (Similar Ligand) |
|---|---|
| CC[C@@H]3/C=C(C)\C[C@H](C)C[C@H](OC)[C@H]4O[C@@](O)(C(=O)C(=O)N1CCCC[C@H]1C(=O)O[C@H](/C(C)=C/[C@@H]2CC[C@H](Cl)[C@H](OC)C2)C(C)[C@@H](O)CC3=O)[C@H](C)C[C@@H]4OC | CC(C)C[C@@H](N)[C@H](O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)O |
|
|
|
|
|
|
| 000f0040 81005000 00900100 80810700 823c00c0 00200800 02002840 28000442 04002040 011000a8 40202000 5001f000 1602802a 02880002 80081408 28289008 10a20000 80000000 33c02010 00002201 00000120 10040f10 17008080 0810001c 10201401 08000400 00c04000 b0000021 00800200 0004000b 24224000 00822a10 | 00050000 01007400 00100000 04000400 00280080 00000000 00000000 20000008 00000000 00000180 00200000 40017000 0e00800a 00002003 80180000 00080008 10000000 00000001 00c02010 00000201 00000000 30100e10 03000083 02100018 00001001 00000000 00000000 10000000 08000002 00040011 20004000 00002200 |