On Target AOFA_HUMAN 0.5135135/CHEMBL3330339
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.5135135, the most similar ligand is CHEMBL3330339. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL3330339 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | C[C@]1(N)C[C@@H]1c2ccccc2.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00000000 01000200 00100102 00010600 00000000 00000000 00000000 00000000 00000800 000808c0 08100000 40008000 00008000 01200000 00000000 00080008 00000000 02000000 00000000 00000005 00000100 18000a00 00000000 81400010 00000000 80000000 00000000 90000000 04000000 0006000a 00000000 00000600 |