On Target PPARG_HUMAN 0.47058824/CHEMBL396109
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.47058824, the most similar ligand is CHEMBL396109. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL396109 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | CCO[C@@H](Cc1ccc(CCC(O)c2ccccc2)cc1)C(=O)O |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00000000 01000000 00000102 00010200 00000040 00004000 00000000 00000040 00000900 00080840 08100000 4000d800 04008000 00200000 00040000 000a0008 08000000 82000000 04400008 00000001 00010120 08000a20 05000040 08400014 00000c00 80000000 00000000 00000020 00000200 00020002 40000000 00000400 |