On Target PPAP_HUMAN 0.14383562/CHEMBL507996
For the given ligand Rofecoxib, we have found in our database that, being scored 0.14383562, the most similar ligand is CHEMBL507996. Check out the elaboration below.
| Rofecoxib (Given Ligand) | CHEMBL507996 (Similar Ligand) |
|---|---|
| CS(=O)(=O)c3ccc(/C2=C(c1ccccc1)/C(=O)OC2)cc3 | Cl.COc1ccc(cc1)[C@@H](N[C@H](C)c2ccccc2)P(=O)(O)O |
|
|
|
|
|
|
| 00000040 00801200 00020100 00910200 00100040 00000000 80000080 00000440 01800000 00080840 48002100 60009000 05008000 00010000 c0240002 00080008 0c020410 02000000 44018018 00002000 80010020 18040a00 01800000 08400019 00001400 80000000 00402000 40000420 00400200 00020002 04002000 00810430 | 00010010 00000608 20000108 00010600 00001000 00400000 06040000 82001000 000000c0 00080840 08200000 40008000 00000802 00020000 8108040d 00000008 00003028 02000000 00000000 00020200 00000000 0d308000 00000000 00400010 00000000 c6010006 00220000 80014000 00000300 30060002 00040000 00028603 |