On Target PPAP_HUMAN 0.19642857/CHEMBL501717
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.19642857, the most similar ligand is CHEMBL501717. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL501717 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | Cl.C[C@@H](N[C@H](c1ccccc1)P(=O)(O)O)c2ccccc2 |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00010010 00000600 00000100 00010600 00000000 00400000 04000000 02001000 000000c0 00080840 08200000 40008000 00000802 00020000 8008040c 00000000 00003028 02000000 00000000 00000200 00000000 0d308000 00000000 00400010 00000000 c6010006 00000000 80014000 00000100 30060002 00040000 00028603 |