On Target PPAP_HUMAN 0.1182266/CHEMBL507996
For the given ligand Pimecrolimus, we have found in our database that, being scored 0.1182266, the most similar ligand is CHEMBL507996. Check out the elaboration below.
| Pimecrolimus (Given Ligand) | CHEMBL507996 (Similar Ligand) |
|---|---|
| CC[C@@H]3/C=C(C)\C[C@H](C)C[C@H](OC)[C@H]4O[C@@](O)(C(=O)C(=O)N1CCCC[C@H]1C(=O)O[C@H](/C(C)=C/[C@@H]2CC[C@H](Cl)[C@H](OC)C2)C(C)[C@@H](O)CC3=O)[C@H](C)C[C@@H]4OC | Cl.COc1ccc(cc1)[C@@H](N[C@H](C)c2ccccc2)P(=O)(O)O |
|
|
|
|
|
|
| 000f0040 81005000 00900100 80810700 823c00c0 00200800 02002840 28000442 04002040 011000a8 40202000 5001f000 1602802a 02880002 80081408 28289008 10a20000 80000000 33c02010 00002201 00000120 10040f10 17008080 0810001c 10201401 08000400 00c04000 b0000021 00800200 0004000b 24224000 00822a10 | 00010010 00000608 20000108 00010600 00001000 00400000 06040000 82001000 000000c0 00080840 08200000 40008000 00000802 00020000 8108040d 00000008 00003028 02000000 00000000 00020200 00000000 0d308000 00000000 00400010 00000000 c6010006 00220000 80014000 00000300 30060002 00040000 00028603 |