On Target CHLE_HUMAN 0.4375/CHEMBL603913
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.4375, the most similar ligand is CHEMBL603913. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL603913 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | O=C(NCc1ccccc1)O[C@H]2CO[C@@H]3[C@H](CCCc4ccccc4)CO[C@H]23 |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00000040 01c00801 0000050a 80010700 000800c0 00000000 00000000 82001040 00002a00 01080840 08300000 40008010 00008800 02a00100 00080000 001a9008 00820000 02000000 01402800 00000001 80000120 18008c10 05000000 0840001c 00000400 80001002 00000000 80200060 00000302 0006000b 80060000 00000600 |