On Target PDE4B_HUMAN 0.41666666/CHEMBL144499
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.41666666, the most similar ligand is CHEMBL144499. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL144499 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | COc1ccc(cc1OC2CCCC2)[C@H]3CCN4[C@@H]3CCC4=O |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 04030000 43001208 2010010a 00210700 00081000 c2000010 02040000 20000004 00000880 000808c0 08300000 40019000 0480c00a 20200080 11000001 020ca008 00800000 02000000 00482000 00020201 00000100 18240610 01000000 81500018 00000000 80000000 00120000 10000000 04000202 0106000b 00020000 00802640 |