On Target PDE4B_HUMAN 0.33526012/CHEMBL239299
For the given ligand Alfentanil, we have found in our database that, being scored 0.33526012, the most similar ligand is CHEMBL239299. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL239299 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | C[C@@H]1CCCN1CCCOc2ccc(cc2)N3CCN(CC3=O)C(=O)c4ccc(F)cc4F.OC=O |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 0400c082 01002808 20100128 06010600 00001000 02000010 02000000 22001008 00000000 00010ac0 00280004 c001a000 02808862 00103001 01200441 00082008 02240200 02000100 08800000 00120201 40100000 38028e00 210020a0 2250001e 00000001 c0000000 00040000 90000081 08008300 00068001 a0044000 00002240 |