On Target DRD2_HUMAN 0.5252525/CHEMBL2308105
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.5252525, the most similar ligand is CHEMBL2308105. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL2308105 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | Fc1ccc(cc1)C(O[C@H]2C[C@H]3CC[C@@H](C2)N3CCCCc4ccccc4)c5ccc(F)cc5 |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00000000 01000000 00100102 02010700 00080010 00004010 00000000 21000000 00100900 000808c0 08300000 50018000 00000002 00a91000 00000000 02081008 00a00000 02000280 00c02000 00100201 00000120 18000030 01000080 00500010 00000401 a0002000 00080000 50001001 00000280 00068002 40020000 02002600 |