On Target NEP_HUMAN 0.40397352/CHEMBL434492
For the given ligand Pimecrolimus, we have found in our database that, being scored 0.40397352, the most similar ligand is CHEMBL434492. Check out the elaboration below.
| Pimecrolimus (Given Ligand) | CHEMBL434492 (Similar Ligand) |
|---|---|
| CC[C@@H]3/C=C(C)\C[C@H](C)C[C@H](OC)[C@H]4O[C@@](O)(C(=O)C(=O)N1CCCC[C@H]1C(=O)O[C@H](/C(C)=C/[C@@H]2CC[C@H](Cl)[C@H](OC)C2)C(C)[C@@H](O)CC3=O)[C@H](C)C[C@@H]4OC | COCCOC[C@H](CC1(CCCC1)C(=O)N[C@@H]2CC[C@@H](CC2)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 000f0040 81005000 00900100 80810700 823c00c0 00200800 02002840 28000442 04002040 011000a8 40202000 5001f000 1602802a 02880002 80081408 28289008 10a20000 80000000 33c02010 00002201 00000120 10040f10 17008080 0810001c 10201401 08000400 00c04000 b0000021 00800200 0004000b 24224000 00822a10 | 00010000 01001000 00100000 00010500 000c0040 00200000 00000000 20000040 00002000 01020080 00200000 40019000 1400803a 01800000 00000000 00089008 00800000 00000000 03402000 00000201 00000020 10040e10 05000000 08100018 00000400 00000000 00000000 10000020 00000200 01040001 00020000 00002200 |