On Target NEP_HUMAN 0.37967914/CHEMBL51389
For the given ligand Alfentanil, we have found in our database that, being scored 0.37967914, the most similar ligand is CHEMBL51389. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL51389 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | OC(=O)CN1C(=O)[C@H](COc2ccccc12)NC(=O)[C@@H](CS)Cc3ccccc3 |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 04006002 00006208 20101128 04110602 a0001080 02200000 02000000 20400008 00030800 00080ac0 083c0004 4001b000 16808002 00142001 811a1041 000c6408 10240000 02000000 08800008 00420201 60140100 38040e00 334023a1 0240801a 00000801 80000080 28800040 10000081 08008200 0006003b 20005c00 01010640 |