On Target HPGDS_HUMAN 0.115384616/CHEMBL3134492
For the given ligand Amantadine, we have found in our database that, being scored 0.115384616, the most similar ligand is CHEMBL3134492. Check out the elaboration below.
| Amantadine (Given Ligand) | CHEMBL3134492 (Similar Ligand) |
|---|---|
| NC23CC1CC(CC(C1)C2)C3 | C1CCC(C1)Nc2ncnc3[nH]ccc23 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000080 00000000 40010000 00000000 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 10000010 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00040000 00020000 00000000 | 00014002 01800800 00180000 08080600 20080000 00006000 00008000 00100800 00000100 00000080 00200004 40011000 04000800 00000000 00020000 100c0004 00040000 00004008 08600000 00200005 40100000 18048060 20804040 00100014 00000000 80000000 00008000 10000080 00000008 01460000 c0001200 000006c0 |