On Target NOS1_HUMAN 0.39655173/CHEMBL1270460
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.39655173, the most similar ligand is CHEMBL1270460. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL1270460 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | Fc1cccc(CCNCCO[C@H]2CNC[C@H]2CC3CCCC(=N)N3)c1 |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00000000 01000000 00100100 82010f00 00180080 00000010 00000000 20002000 00200280 000828c3 08210000 50038000 00000002 00881000 00081008 00181008 10a00000 02000000 00c02000 00000201 00000020 18230030 13000080 81500010 30000400 80000000 c0000200 10000001 04200210 00068002 80020000 00002e00 |