On Target NK1R_HUMAN 0.30813953/CHEMBL93184
For the given ligand Rofecoxib, we have found in our database that, being scored 0.30813953, the most similar ligand is CHEMBL93184. Check out the elaboration below.
| Rofecoxib (Given Ligand) | CHEMBL93184 (Similar Ligand) |
|---|---|
| CS(=O)(=O)c3ccc(/C2=C(c1ccccc1)/C(=O)OC2)cc3 | COc1ccccc1C2=CC3(CCCNC3c4ccccc4)OC2 |
|
|
|
|
|
|
| 00000040 00801200 00020100 00910200 00100040 00000000 80000080 00000440 01800000 00080840 48002100 60009000 05008000 00010000 c0240002 00080008 0c020410 02000000 44018018 00002000 80010020 18040a00 01800000 08400019 00001400 80000000 00402000 40000420 00400200 00020002 04002000 00810430 | 00040040 09000008 2011030a 80110700 003010c0 00000000 82080080 3a009640 00000804 001808ca 48300000 50018100 04020802 00200000 010c140b 00083008 18000410 02000040 1441201c 00020201 00010120 18008010 13008020 00500010 11001400 c0000400 00406200 d0000401 00400302 00060c03 24040000 00012e10 |