On Target NK1R_HUMAN 0.65217394/CHEMBL209531
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.65217394, the most similar ligand is CHEMBL209531. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL209531 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | CNC[C@@H]1CC[C@H](OCc2cc(cc(c2)C(F)(F)F)C(F)(F)F)[C@H]1c3ccccc3 |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00000000 010c0200 00100102 00010700 00180051 00004000 00000400 00000040 00000900 000808d0 08300000 40018002 00000000 01a10000 00040000 020c1008 08800000 02000000 04402000 40000001 00010120 18000030 01000000 00500010 00000400 80002000 00080200 90000000 00000202 0106000a 40120004 02000e00 |