On Target NK1R_HUMAN 0.45833334/CHEMBL2313628
For the given ligand Alfentanil, we have found in our database that, being scored 0.45833334, the most similar ligand is CHEMBL2313628. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL2313628 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | CCC(=O)N(C1CCN(CCN2C(=O)N(C(=C)C)c3ccccc23)CC1)c4cccc(Cl)c4 |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 0040c002 81001400 00100000 41010700 201c0040 00004000 08080000 20000400 14200101 000009e4 0d28900c 50099800 02009006 01500001 003208c4 010c1004 00840804 00000100 08610000 00004201 e0100000 38080730 21802001 02300018 1c002000 40000000 00000000 90000080 08008000 00460011 44080000 00022a80 |