On Target ALDR_HUMAN 0.33333334/CHEMBL319244
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL319244. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL319244 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | Oc1ccc(\C=C\C(=O)OCCc2ccccc2)cc1O |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00040000 40000008 20000100 00010200 00000040 00000000 82000080 00000440 01800000 00080840 48000000 40108000 04008002 00000000 00040002 00088008 08020400 02000000 24018018 00020200 00010020 08000a00 01000001 00400010 00001400 80000000 00422000 40000400 00400200 00020102 04000000 00000410 |