On Target AOFB_HUMAN 0.28444445/CHEMBL4062286
For the given ligand Pimecrolimus, we have found in our database that, being scored 0.28444445, the most similar ligand is CHEMBL4062286. Check out the elaboration below.
| Pimecrolimus (Given Ligand) | CHEMBL4062286 (Similar Ligand) |
|---|---|
| CC[C@@H]3/C=C(C)\C[C@H](C)C[C@H](OC)[C@H]4O[C@@](O)(C(=O)C(=O)N1CCCC[C@H]1C(=O)O[C@H](/C(C)=C/[C@@H]2CC[C@H](Cl)[C@H](OC)C2)C(C)[C@@H](O)CC3=O)[C@H](C)C[C@@H]4OC | COc1c(OC\C=C(/C)\C[C@H]2OC(=O)C(=C2)CCC(=O)N)ccc3C=CC(=O)Oc13 |
|
|
|
|
|
|
| 000f0040 81005000 00900100 80810700 823c00c0 00200800 02002840 28000442 04002040 011000a8 40202000 5001f000 1602802a 02880002 80081408 28289008 10a20000 80000000 33c02010 00002201 00000120 10040f10 17008080 0810001c 10201401 08000400 00c04000 b0000021 00800200 0004000b 24224000 00822a10 | 0c050040 01200028 20080108 00210700 001d1214 00400820 02000080 68000602 130a4000 401208c0 40000200 40419000 4682c432 01200080 01000485 02089009 00820010 00000040 08410010 02028003 00040020 18001e88 0120a008 00180010 08601500 00000400 00406011 88100000 06042200 8106080a 04000000 00800010 |