On Target AOFB_HUMAN 0.31333333/CHEMBL3781329
For the given ligand Alfentanil, we have found in our database that, being scored 0.31333333, the most similar ligand is CHEMBL3781329. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL3781329 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | Cl.N[C@@H]1C[C@H]1c2ccc(NC(=O)c3ccc(cc3)N4CCOCC4)cc2 |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 00004002 00000a00 00001100 c0010600 00000080 00000000 00000000 02001000 00000800 000808c0 083c0004 4000c000 00008802 01108000 00001048 00080108 10040000 02000000 08000000 00000001 40100100 18028600 32012000 81400014 00000400 80000000 08000000 80000080 04008300 0006000b 80040000 00020600 |