On Target ACM1_HUMAN 0.73417723/CHEMBL285440
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.73417723, the most similar ligand is CHEMBL285440. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL285440 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | CN(C)CCCCOC(=O)C(C)(C1CCCCC1)c2ccccc2 |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00010040 01000000 00100102 00010700 00180040 00000000 00000000 00000040 00000800 000808c0 08300000 40009000 05008008 00a00000 40040000 00081008 08820000 02000000 06402000 00000001 00010120 18000a00 01000000 00400010 00000400 80000000 00000200 10000000 00000202 00060002 00022000 00000e00 |