On Target PGH1_SHEEP 0.742268/CHEMBL259402
For the given ligand Rofecoxib, we have found in our database that, being scored 0.742268, the most similar ligand is CHEMBL259402. Check out the elaboration below.
| Rofecoxib (Given Ligand) | CHEMBL259402 (Similar Ligand) |
|---|---|
| CS(=O)(=O)c3ccc(/C2=C(c1ccccc1)/C(=O)OC2)cc3 | CS(=O)(=O)c1ccc(\C=C(\C(=O)O)/c2ccc(Br)cc2)cc1 |
|
|
|
|
|
|
| 00000040 00801200 00020100 00910200 00100040 00000000 80000080 00000440 01800000 00080840 48002100 60009000 05008000 00010000 c0240002 00080008 0c020410 02000000 44018018 00002000 80010020 18040a00 01800000 08400019 00001400 80000000 00402000 40000420 00400200 00020002 04002000 00810430 | 00004000 00809200 00020100 00910200 00000040 00000000 80000080 00000400 01800000 00080840 08002100 60009000 05008010 00010000 c0640002 00080008 0c000400 02000400 40018018 00002000 80000000 18000a00 01800000 08400019 00001000 80000000 00522000 40000020 00400000 00060002 04002008 08010420 |