On Target PGH1_SHEEP 0.44871795/CHEMBL1945285
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.44871795, the most similar ligand is CHEMBL1945285. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL1945285 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | CC(C)Cc1ccc(cc1)[C@H](CF)C(=O)O |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00000000 00000000 00100100 00010200 00000040 00000020 00000000 00000000 00000900 40080840 08100000 40009800 01008000 00200000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00580010 00000000 80000000 00000080 10000000 00000000 00020002 00002000 00000600 |