On Target PGH1_SHEEP 0.5090909/CHEMBL502799
For the given ligand Pimecrolimus, we have found in our database that, being scored 0.5090909, the most similar ligand is CHEMBL502799. Check out the elaboration below.
| Pimecrolimus (Given Ligand) | CHEMBL502799 (Similar Ligand) |
|---|---|
| CC[C@@H]3/C=C(C)\C[C@H](C)C[C@H](OC)[C@H]4O[C@@](O)(C(=O)C(=O)N1CCCC[C@H]1C(=O)O[C@H](/C(C)=C/[C@@H]2CC[C@H](Cl)[C@H](OC)C2)C(C)[C@@H](O)CC3=O)[C@H](C)C[C@@H]4OC | CC(C)[C@@H](N(C)C)C(=O)O[C@@H]1[C@@H](C)[C@@]2(O)[C@@H](C=C(CO)C[C@]3(O)[C@H]2C=C(C)C3=O)[C@@H]4C(C)(C)[C@]14OC(=O)C |
|
|
|
|
|
|
| 000f0040 81005000 00900100 80810700 823c00c0 00200800 02002840 28000442 04002040 011000a8 40202000 5001f000 1602802a 02880002 80081408 28289008 10a20000 80000000 33c02010 00002201 00000120 10040f10 17008080 0810001c 10201401 08000400 00c04000 b0000021 00800200 0004000b 24224000 00822a10 | 00050040 81000000 00100d08 80010700 002800c0 00000000 00000280 28000442 01002000 01100008 00200200 4000f000 04028028 03800000 0000140c 00099008 00820000 00000000 13412010 02002001 00000020 10000a80 17008000 08000010 10201480 00200400 00404200 80001020 00000200 8004000a 24024000 00000200 |