On Target NMDE2_HUMAN 0.21714285/CHEMBL17350
For the given ligand Pimecrolimus, we have found in our database that, being scored 0.21714285, the most similar ligand is CHEMBL17350. Check out the elaboration below.
| Pimecrolimus (Given Ligand) | CHEMBL17350 (Similar Ligand) |
|---|---|
| CC[C@@H]3/C=C(C)\C[C@H](C)C[C@H](OC)[C@H]4O[C@@](O)(C(=O)C(=O)N1CCCC[C@H]1C(=O)O[C@H](/C(C)=C/[C@@H]2CC[C@H](Cl)[C@H](OC)C2)C(C)[C@@H](O)CC3=O)[C@H](C)C[C@@H]4OC | C[C@@H]([C@@H](O)c1ccc(O)cc1)N2CCC(O)(CC2)c3ccccc3 |
|
|
|
|
|
|
| 000f0040 81005000 00900100 80810700 823c00c0 00200800 02002840 28000442 04002040 011000a8 40202000 5001f000 1602802a 02880002 80081408 28289008 10a20000 80000000 33c02010 00002201 00000120 10040f10 17008080 0810001c 10201401 08000400 00c04000 b0000021 00800200 0004000b 24224000 00822a10 | 00000000 01000208 20100100 00010600 00000080 00004000 02000000 20000000 00000980 000808c0 08300000 50018000 00000002 00000000 00080000 000c0008 10000000 02000000 00800000 00020201 00000100 18200020 03000080 81500010 00000001 80000000 00520000 10000000 04000000 0006000a 40000000 00002600 |