On Target GRM5_HUMAN 0.32061067/CHEMBL92162
For the given ligand Rofecoxib, we have found in our database that, being scored 0.32061067, the most similar ligand is CHEMBL92162. Check out the elaboration below.
| Rofecoxib (Given Ligand) | CHEMBL92162 (Similar Ligand) |
|---|---|
| CS(=O)(=O)c3ccc(/C2=C(c1ccccc1)/C(=O)OC2)cc3 | N[C@@](CC1c2ccccc2Sc3ccccc13)([C@@H]4C[C@@H](C4)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00000040 00801200 00020100 00910200 00100040 00000000 80000080 00000440 01800000 00080840 48002100 60009000 05008000 00010000 c0240002 00080008 0c020410 02000000 44018018 00002000 80010020 18040a00 01800000 08400019 00001400 80000000 00402000 40000420 00400200 00020002 04002000 00810430 | 00010000 01800200 00020102 00110600 000e0000 00100020 00000000 01004002 00000800 000808c0 08100400 6001b000 0c008018 01a00010 00000000 00080008 04001000 02000004 00602010 00000001 80000100 18000a00 03800000 00400019 00003000 a0000000 00000000 40001000 00000282 0007000a 00020100 00410420 |