On Target P2RX3_HUMAN 0.36057693/CHEMBL3669852
For the given ligand Pimecrolimus, we have found in our database that, being scored 0.36057693, the most similar ligand is CHEMBL3669852. Check out the elaboration below.
| Pimecrolimus (Given Ligand) | CHEMBL3669852 (Similar Ligand) |
|---|---|
| CC[C@@H]3/C=C(C)\C[C@H](C)C[C@H](OC)[C@H]4O[C@@](O)(C(=O)C(=O)N1CCCC[C@H]1C(=O)O[C@H](/C(C)=C/[C@@H]2CC[C@H](Cl)[C@H](OC)C2)C(C)[C@@H](O)CC3=O)[C@H](C)C[C@@H]4OC | CCOC(=O)C1C(C(=O)C(C)C)C(=O)C(=O)N1c2ccc(cc2)c3ccsc3 |
|
|
|
|
|
|
| 000f0040 81005000 00900100 80810700 823c00c0 00200800 02002840 28000442 04002040 011000a8 40202000 5001f000 1602802a 02880002 80081408 28289008 10a20000 80000000 33c02010 00002201 00000120 10040f10 17008080 0810001c 10201401 08000400 00c04000 b0000021 00800200 0004000b 24224000 00822a10 | 00076002 01005800 00101900 80010700 20180080 00002010 40000000 20000080 04000100 000208c0 003c2204 5001b080 0e00803a 01908003 800a1049 00081008 10860000 02000101 0c402010 00000201 40100020 58060e90 33002000 00500018 00801400 84100080 08800000 100000c5 0000c202 00060001 20005000 00c10200 |