On Target P2RX3_HUMAN 0.3888889/CHEMBL3669852
For the given ligand Alfentanil, we have found in our database that, being scored 0.3888889, the most similar ligand is CHEMBL3669852. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL3669852 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | CCOC(=O)C1C(C(=O)C(C)C)C(=O)C(=O)N1c2ccc(cc2)c3ccsc3 |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 00076002 01005800 00101900 80010700 20180080 00002010 40000000 20000080 04000100 000208c0 003c2204 5001b080 0e00803a 01908003 800a1049 00081008 10860000 02000101 0c402010 00000201 40100020 58060e90 33002000 00500018 00801400 84100080 08800000 100000c5 0000c202 00060001 20005000 00c10200 |