On Target DRD3_HUMAN 0.26530612/CHEMBL165381
For the given ligand Amantadine, we have found in our database that, being scored 0.26530612, the most similar ligand is CHEMBL165381. Check out the elaboration below.
| Amantadine (Given Ligand) | CHEMBL165381 (Similar Ligand) |
|---|---|
| NC23CC1CC(CC(C1)C2)C3 | CCCN(CCC)CC[C@@H]1CC[C@H](CC1)Nc2ncccn2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000080 00000000 40010000 00000000 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 10000010 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00040000 00020000 00000000 | 00000002 01000000 00100000 00000600 00000000 00004000 00002000 20100000 00000100 20000080 00200004 40010000 00000002 00000000 00000000 000c0004 00000000 00004000 02402000 00a00201 00000000 14000010 20800840 00100010 00000000 00000000 00000000 10000000 00000008 00460800 40021000 00002280 |