On Target OPRM_MOUSE 0.45714286/CHEMBL440765
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.45714286, the most similar ligand is CHEMBL440765. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL440765 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | CN([C@H]1CC[C@@]2(CCCO2)C[C@@H]1N3CCCC3)C(=O)Cc4ccccc4 |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00000040 01003000 00100100 04010700 00180000 00000010 00000000 20000008 00000080 000808c0 08200000 40019000 01008002 01882000 40080000 00081008 00a00000 02000000 02c02000 00000201 00000020 38240610 01000081 83500018 00000401 80000000 00000200 10000000 0c000200 00060003 00022000 00002e00 |