On Target P2Y12_HUMAN 0.35820895/CHEMBL88730
For the given ligand Rofecoxib, we have found in our database that, being scored 0.35820895, the most similar ligand is CHEMBL88730. Check out the elaboration below.
| Rofecoxib (Given Ligand) | CHEMBL88730 (Similar Ligand) |
|---|---|
| CS(=O)(=O)c3ccc(/C2=C(c1ccccc1)/C(=O)OC2)cc3 | CCOC(=O)\C=C\c1ccc2[nH]c3nc(O)nc3cc2c1 |
|
|
|
|
|
|
| 00000040 00801200 00020100 00910200 00100040 00000000 80000080 00000440 01800000 00080840 48002100 60009000 05008000 00010000 c0240002 00080008 0c020410 02000000 44018018 00002000 80010020 18040a00 01800000 08400019 00001400 80000000 00402000 40000420 00400200 00020002 04002000 00810430 | 00004002 02000810 00084100 00010200 000c0040 0000c000 82008080 00000400 01c00100 00000840 40008004 40008000 04008800 00c00000 60040142 000c000c 08020400 02000004 20218018 00000000 40020000 08008a28 21800000 80400004 00001400 80000000 0042a040 40000400 00400200 00420000 e4040000 0c000490 |