On Target P2Y12_HUMAN 0.36434108/CHEMBL88799
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.36434108, the most similar ligand is CHEMBL88799. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL88799 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | Oc1nc2cc3cc(CCCCC(=O)NC45C[C@@H]6C[C@@H](C[C@@H](C6)C4)C5)ccc3[nH]c2n1 |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00014002 03005810 00184102 00010600 000c0040 0000c000 00008000 20000000 00400900 000808c0 08308004 40019000 0400880a 00e00000 60040140 000c000c 08000000 02000004 02202000 00000201 40020100 18048638 21800000 8050001c 00000000 80000000 00028040 10000000 00400002 00460003 c0060000 0c002680 |