On Target P2Y12_HUMAN 0.36516854/CHEMBL90804
For the given ligand Alfentanil, we have found in our database that, being scored 0.36516854, the most similar ligand is CHEMBL90804. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL90804 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | COC(=O)CN(C1CCCCC1)C(=O)CCCOc2ccc3[nH]c4nc(O)nc4cc3c2 |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 04044002 03005818 20184008 00010700 001c10c0 0200c000 06088000 20000000 00400100 000008c0 00208004 4001b000 06808806 00c00000 f10c1141 000c200c 18020000 00000100 02602000 00020201 40020000 18048e38 33800000 8010001c 00002000 00000000 00828200 10000001 00000200 00460001 e0044000 0c002e80 |