On Target NOS2_HUMAN 0.29577464/CHEMBL1762474
For the given ligand Rofecoxib, we have found in our database that, being scored 0.29577464, the most similar ligand is CHEMBL1762474. Check out the elaboration below.
| Rofecoxib (Given Ligand) | CHEMBL1762474 (Similar Ligand) |
|---|---|
| CS(=O)(=O)c3ccc(/C2=C(c1ccccc1)/C(=O)OC2)cc3 | NCC[C@@H](Sc1cc(Cl)ccc1C#N)c2ccccc2.OC(=O)\C=C\C(=O)O |
|
|
|
|
|
|
| 00000040 00801200 00020100 00910200 00100040 00000000 80000080 00000440 01800000 00080840 48002100 60009000 05008000 00010000 c0240002 00080008 0c020410 02000000 44018018 00002000 80010020 18040a00 01800000 08400019 00001400 80000000 00402000 40000420 00400200 00020002 04002000 00810430 | 00008202 00800a00 00022500 00110640 00000020 00100030 40000000 00000400 01000800 008848c0 08500000 60008800 02019005 40040200 02000000 00084008 04400008 02400100 20a10010 00000001 80000100 18400b00 00800600 00400019 00003000 80081000 20440000 00000000 00000000 0006042a 14000000 01030420 |