On Target NOS2_HUMAN 0.33333334/CHEMBL1762476
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL1762476. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL1762476 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | CNCC[C@@H](Oc1cc(OC)ccc1C#N)c2ccccc2.OC(=O)C(=O)O |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 04000005 00000208 20100108 00010600 00001020 02004000 42040000 00000000 04000900 008808c0 08300000 4000c000 00808002 00010000 01000001 020c2008 00600000 22008004 00800000 00022801 40000100 18000a20 05000480 00c01010 00004000 80002000 00020000 10000000 00010300 0006042a 40000000 00000640 |