On Target PRGR_HUMAN 0.37790698/CHEMBL2419306
For the given ligand Rofecoxib, we have found in our database that, being scored 0.37790698, the most similar ligand is CHEMBL2419306. Check out the elaboration below.
| Rofecoxib (Given Ligand) | CHEMBL2419306 (Similar Ligand) |
|---|---|
| CS(=O)(=O)c3ccc(/C2=C(c1ccccc1)/C(=O)OC2)cc3 | CC1OC(=O)C(=C1c2ccc3OCC(=O)Nc3c2)c4ccc(F)cc4 |
|
|
|
|
|
|
| 00000040 00801200 00020100 00910200 00100040 00000000 80000080 00000440 01800000 00080840 48002100 60009000 05008000 00010000 c0240002 00080008 0c020410 02000000 44018018 00002000 80010020 18040a00 01800000 08400019 00001400 80000000 00402000 40000420 00400200 00020002 04002000 00810430 | 04006042 00000008 60101308 02010602 841010c4 00000010 82040080 00000440 01c20800 00180850 483c0104 4000d000 05808002 00101800 410c1043 00084408 08060410 82000080 2c018018 00120003 45110120 18040e80 3300a001 00408010 01041400 80000400 28522048 40000489 00408200 00068003 04002000 00800610 |