On Target PRGR_HUMAN 0.3923077/CHEMBL197161
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.3923077, the most similar ligand is CHEMBL197161. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL197161 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | CC(C)(CC(O)(Cc1ccccc1)C(=O)Nc2ccc3C(=O)OCc3c2)c4ccccc4 |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00014002 01000a00 40101102 80090600 240000d0 0800e000 00000000 00000000 00100900 000808d0 08380004 4001d800 04008000 00318000 00060040 020c0008 08060000 02000200 08412008 80000001 40100100 18020f20 23002040 00500014 00040c00 80002000 08080000 10000080 00428202 0006000b c0000000 00400600 |