On Target CXCR1_HUMAN 0.26086956/CHEMBL191413
For the given ligand Rofecoxib, we have found in our database that, being scored 0.26086956, the most similar ligand is CHEMBL191413. Check out the elaboration below.
| Rofecoxib (Given Ligand) | CHEMBL191413 (Similar Ligand) |
|---|---|
| CS(=O)(=O)c3ccc(/C2=C(c1ccccc1)/C(=O)OC2)cc3 | CC(C)Cc1ccc(cc1)[C@@H](C)C(=O)NS(=O)(=O)C |
|
|
|
|
|
|
| 00000040 00801200 00020100 00910200 00100040 00000000 80000080 00000440 01800000 00080840 48002100 60009000 05008000 00010000 c0240002 00080008 0c020410 02000000 44018018 00002000 80010020 18040a00 01800000 08400019 00001400 80000000 00402000 40000420 00400200 00020002 04002000 00810430 | 00000040 20000000 00000100 01310600 00000000 00000000 00010000 00001000 00000900 00480840 08102000 40009800 01008001 00000001 c0000000 00000000 02000000 02000000 00000000 00004001 00000100 18000600 00000000 91400010 02000000 80000000 00000000 0000000c 04000000 00060002 00002000 00010660 |