On Target PGH2_HUMAN 0.47435898/CHEMBL441414
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.47435898, the most similar ligand is CHEMBL441414. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL441414 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | C[C@H](C(=O)O)c1ccc(C[C@H]2CCC[C@@H]2O)cc1 |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00000000 01000000 00000102 00010200 00080040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00a00000 40040000 00080008 08000000 02000000 00402000 00000001 00000100 08000a00 01000040 00400010 00000000 80000000 00000000 00000000 00000002 01020002 00022000 00000400 |