On Target TRY1_HUMAN 0.5/CHEMBL102081
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL102081. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL102081 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | O=C1O[C@H]2CCC[C@@H]2[C@H]1Cc3ccccc3 |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00050040 01000008 00000102 00010300 00080000 00000000 00000000 00000000 00000800 00080840 08100000 40009000 04008008 00a00000 00080000 00081008 00820000 02000000 00402008 00000001 00000120 08000a00 01000040 00400010 00000c00 80000000 00000000 00000000 00000202 01020002 00020000 00000400 |