On Target ACE_HUMAN 0.21428572/CHEMBL110870
For the given ligand Amantadine, we have found in our database that, being scored 0.21428572, the most similar ligand is CHEMBL110870. Check out the elaboration below.
| Amantadine (Given Ligand) | CHEMBL110870 (Similar Ligand) |
|---|---|
| NC23CC1CC(CC(C1)C2)C3 | CC(NP(=O)(O)O)C(=O)C1CCCC1C(=O)O |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000080 00000000 40010000 00000000 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 10000010 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00040000 00020000 00000000 | 00050000 01000000 10000000 00000400 00080000 00000000 00000000 00000020 01000000 000000a4 00000000 48013008 04008018 01820000 00002000 00280008 00000030 00000001 00432000 00000001 20000000 16080a90 01000000 00000010 00000000 00000000 00000000 20018000 00000002 01040000 00020000 00008000 |