On Target 5HT1B_HUMAN 0.42372882/CHEMBL79693
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.42372882, the most similar ligand is CHEMBL79693. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL79693 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | NC(=O)c1ccc2C(CCN3CCC(CC3)c4cccc5ccccc45)OCCc2c1 |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00000040 01000a00 00100500 40050600 00000051 00004002 00000000 20001041 00000900 00080ac0 08300000 50018800 80008802 00290000 00040000 0a0c0008 08200000 02000000 04800402 00000201 00010120 18028628 01004080 00500014 00000401 80002201 08080000 10000004 00000201 0006080a c0040000 02002600 |