On Target TLR4_HUMAN 0.35211268/CHEMBL1223752
For the given ligand Alfentanil, we have found in our database that, being scored 0.35211268, the most similar ligand is CHEMBL1223752. Check out the elaboration below.
| Alfentanil (Given Ligand) | CHEMBL1223752 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3(COC)CCN(CCn2nnn(CC)c2=O)CC3 | CC(C)CC(=O)Nc1ccc(OC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
|
|
|
|
|
|
| 00004002 01005418 40101000 00010700 20100080 00000008 08000000 20000000 04200001 000009e0 002c0004 50019000 0000800e 00500000 400a1e40 0008100c 10042000 00000800 08c00000 00040201 60160000 38080600 33002081 02300018 14044001 00000004 08800200 14000081 08008200 00060011 80000000 08002a00 | 04014002 01000008 20100008 00010700 20081000 02002000 02000000 00000008 00000000 000008c0 00280004 40009000 0480802a 00900000 11030041 00082008 00860000 00000000 0a402000 00020001 40100000 18000e00 31002000 00000010 00000000 00000000 00040000 10000080 00008200 00060001 00020000 10000200 |