On Target CXCR4_HUMAN 0.27131784/CHEMBL126657
For the given ligand Rofecoxib, we have found in our database that, being scored 0.27131784, the most similar ligand is CHEMBL126657. Check out the elaboration below.
| Rofecoxib (Given Ligand) | CHEMBL126657 (Similar Ligand) |
|---|---|
| CS(=O)(=O)c3ccc(/C2=C(c1ccccc1)/C(=O)OC2)cc3 | COc1cc(\C=C\C(=O)c2ccc(Cl)cc2)ccc1O |
|
|
|
|
|
|
| 00000040 00801200 00020100 00910200 00100040 00000000 80000080 00000440 01800000 00080840 48002100 60009000 05008000 00010000 c0240002 00080008 0c020410 02000000 44018018 00002000 80010020 18040a00 01800000 08400019 00001400 80000000 00402000 40000420 00400200 00020002 04002000 00810430 | 00008000 40000808 20000308 00010200 00001000 00800000 82000081 00000400 01800000 00b80840 08000000 40108800 0200c026 00000000 01000003 00008008 00000400 02100000 00098000 00020a00 00000000 08020300 00008001 00400014 01002000 80000000 00462000 40000000 00400200 00020102 84000000 00020500 |