On Target CXCR4_HUMAN 0.34615386/CHEMBL366033
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.34615386, the most similar ligand is CHEMBL366033. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL366033 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | NC(=N)NCCC[C@@H]1NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@@H](Cc2ccc(O)cc2)NC(=O)CNC(=O)[C@H](Cc3ccc4ccccc4c3)NC1=O |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00030000 01003208 20100100 04010e00 00180000 00000000 02000000 2000200c 00200a80 000a08c2 08300000 4003b000 06009032 01002001 80000000 001c0008 00000000 02000000 00400008 00020201 00000100 38250e28 01000003 83500018 00000800 80000000 40120000 10000000 0c000010 0006000b a0084000 00802e00 |