On Target NTRK1_HUMAN 0.30246913/CHEMBL3912980
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.30246913, the most similar ligand is CHEMBL3912980. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL3912980 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | CC(C)n1cc(C(=O)c2cncc(NC(=O)Cc3cccc(CC(C)(C)O)c3)c2)c4cnccc14 |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 08004002 00805800 40104100 40010638 240c5041 08000010 00002000 01000004 00400800 400808d0 08380004 40019000 81008800 00f00000 400600c1 100c000c 08070000 8280000c 08600400 00000005 c4100100 18268610 21802040 8150001d 00042002 a0100000 08000440 50804084 24400080 00460003 a0046200 000006a0 |