On Target OPRX_HUMAN 0.30075186/CHEMBL364625
For the given ligand Rofecoxib, we have found in our database that, being scored 0.30075186, the most similar ligand is CHEMBL364625. Check out the elaboration below.
| Rofecoxib (Given Ligand) | CHEMBL364625 (Similar Ligand) |
|---|---|
| CS(=O)(=O)c3ccc(/C2=C(c1ccccc1)/C(=O)OC2)cc3 | COC(=O)C(CCN1CCC(O)(CC1)c2cccc(c2)C(F)(F)F)(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00000040 00801200 00020100 00910200 00100040 00000000 80000080 00000440 01800000 00080840 48002100 60009000 05008000 00010000 c0240002 00080008 0c020410 02000000 44018018 00002000 80010020 18040a00 01800000 08400019 00001400 80000000 00402000 40000420 00400200 00020002 04002000 00810430 | 00020000 01050200 00100100 00010700 00100041 00004000 00000400 21000040 00000900 000808d0 08300000 50019002 05008002 01000000 40040000 000c0008 08020000 02000000 04c00000 40000201 00000100 18000a20 01000080 00500010 00000001 a0000000 00000200 d0000000 00000280 0006000a 40102000 00802e00 |