On Target OPRX_HUMAN 0.58762884/CHEMBL364625
For the given ligand Levacetylmethadol, we have found in our database that, being scored 0.58762884, the most similar ligand is CHEMBL364625. Check out the elaboration below.
| Levacetylmethadol (Given Ligand) | CHEMBL364625 (Similar Ligand) |
|---|---|
| CC[C@H](OC(C)=O)C(C[C@H](C)N(C)C)(c1ccccc1)c2ccccc2 | COC(=O)C(CCN1CCC(O)(CC1)c2cccc(c2)C(F)(F)F)(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00000000 01000200 00100102 00010700 00180040 00000000 00000000 01000040 00000800 000808c0 08300000 40018000 00008000 00200000 00040000 000c1008 08820000 02000000 04402000 00000001 00010120 18000a10 01000000 00500010 00000400 a0000000 00000200 50000000 00000280 0006000a 00020000 00000e00 | 00020000 01050200 00100100 00010700 00100041 00004000 00000400 21000040 00000900 000808d0 08300000 50019002 05008002 01000000 40040000 000c0008 08020000 02000000 04c00000 40000201 00000100 18000a20 01000080 00500010 00000001 a0000000 00000200 d0000000 00000280 0006000a 40102000 00802e00 |